C41H67O11P — CID 156967489
[(2R)-1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5S,6S,7E,9E,11Z,13E,15S)-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoate (PubChem CID 156967489) has the molecular formula C41H67O11P and a molecular weight of 766.95 g/mol. Its IUPAC name is [(2R)-1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5S,6S,7E,9E,11Z,13E,15S)-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoate.
| Compound Name | [(2R)-1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5S,6S,7E,9E,11Z,13E,15S)-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoate |
|---|---|
| PubChem CID | 156967489 |
| Molecular Formula | C41H67O11P |
| Molecular Weight | 766.95 g/mol |
| Exact Mass | 766.44 |
| IUPAC Name | [(2R)-1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5S,6S,7E,9E,11Z,13E,15S)-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC[C@H](O)[C@@H](O)/C=C/C=C/C=C\C=C\[C@@H](O)CCCCC |
| InChI | InChI=1S/C41H67O11P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-22-26-32-40(45)50-34-37(35-51-53(47,48)49)52-41(46)33-27-31-39(44)38(43)30-25-21-19-18-20-24-29-36(42)28-23-6-4-2/h9-10,12-13,15-16,18-21,24-25,29-30,36-39,42-44H,3-8,11,14,17,22-23,26-28,31-35H2,1-2H3,(H2,47,48,49)/b10-9-,13-12-,16-15-,20-18-,21-19+,29-24+,30-25+/t36-,37+,38-,39-/m0/s1 |
| InChIKey | LTVKSPILFVBYFB-WSUJERDHSA-N |
| XLogP | 8.20 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.95 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|