C14H14N4O3 — CID 157018296
5-[5-(2,3-dimethoxyphenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 157018296) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-[5-(2,3-dimethoxyphenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[5-(2,3-dimethoxyphenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 157018296 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-[5-(2,3-dimethoxyphenyl)furan-2-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(-c2ccc(-c3nc(N)n[nH]3)o2)c1OC |
| InChI | InChI=1S/C14H14N4O3/c1-19-10-5-3-4-8(12(10)20-2)9-6-7-11(21-9)13-16-14(15)18-17-13/h3-7H,1-2H3,(H3,15,16,17,18) |
| InChIKey | QFLDDOBCAVRSJL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |