C22H33NO2S — CID 157024537
S-[(2Z,4Z)-3-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]hexa-2,4-dien-2-yl] prop-2-ynethioate (PubChem CID 157024537) has the molecular formula C22H33NO2S and a molecular weight of 375.58 g/mol. Its IUPAC name is S-[(2Z,4Z)-3-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]hexa-2,4-dien-2-yl] prop-2-ynethioate.
| Compound Name | S-[(2Z,4Z)-3-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]hexa-2,4-dien-2-yl] prop-2-ynethioate |
|---|---|
| PubChem CID | 157024537 |
| Molecular Formula | C22H33NO2S |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | S-[(2Z,4Z)-3-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]hexa-2,4-dien-2-yl] prop-2-ynethioate |
| SMILES | C#CC(=O)S/C(C)=C(/C=C\C)NC(=O)C1(CC(CC)CC)CCCCC1 |
| InChI | InChI=1S/C22H33NO2S/c1-6-13-19(17(5)26-20(24)9-4)23-21(25)22(14-11-10-12-15-22)16-18(7-2)8-3/h4,6,13,18H,7-8,10-12,14-16H2,1-3,5H3,(H,23,25)/b13-6-,19-17- |
| InChIKey | MQUPEXNRAIFQCA-NNSJXWPCSA-N |
| XLogP | 5.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|