C23H18F3N5O2 — CID 15702790
7-[(2-hydroxy-2-phenylethyl)amino]-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one (PubChem CID 15702790) has the molecular formula C23H18F3N5O2 and a molecular weight of 453.42 g/mol. Its IUPAC name is 7-[(2-hydroxy-2-phenylethyl)amino]-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one.
| Compound Name | 7-[(2-hydroxy-2-phenylethyl)amino]-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one |
|---|---|
| PubChem CID | 15702790 |
| Molecular Formula | C23H18F3N5O2 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 7-[(2-hydroxy-2-phenylethyl)amino]-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one |
| SMILES | O=c1nc(NCC(O)c2ccccc2)n2c3c1cnn3C(c1cccc(C(F)(F)F)c1)=CC2 |
| InChI | InChI=1S/C23H18F3N5O2/c24-23(25,26)16-8-4-7-15(11-16)18-9-10-30-21-17(12-28-31(18)21)20(33)29-22(30)27-13-19(32)14-5-2-1-3-6-14/h1-9,11-12,19,32H,10,13H2,(H,27,29,33) |
| InChIKey | JMHICXVAJLZQOF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |