C22H16F3N5O — CID 21223949
7-(benzylamino)-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one (PubChem CID 21223949) has the molecular formula C22H16F3N5O and a molecular weight of 423.40 g/mol. Its IUPAC name is 7-(benzylamino)-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one.
| Compound Name | 7-(benzylamino)-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one |
|---|---|
| PubChem CID | 21223949 |
| Molecular Formula | C22H16F3N5O |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 7-(benzylamino)-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-5-one |
| SMILES | O=c1nc(NCc2ccccc2)n2c3c1cnn3C(c1cccc(C(F)(F)F)c1)=CC2 |
| InChI | InChI=1S/C22H16F3N5O/c23-22(24,25)16-8-4-7-15(11-16)18-9-10-29-20-17(13-27-30(18)20)19(31)28-21(29)26-12-14-5-2-1-3-6-14/h1-9,11,13H,10,12H2,(H,26,28,31) |
| InChIKey | HXXZARJXUJEWCO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |