C29H27F3N6O2 — CID 139887245
2-(4-benzylpiperidin-1-yl)-N-[5-oxo-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-7-yl]acetamide (PubChem CID 139887245) has the molecular formula C29H27F3N6O2 and a molecular weight of 548.57 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-[5-oxo-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-7-yl]acetamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-[5-oxo-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-7-yl]acetamide |
|---|---|
| PubChem CID | 139887245 |
| Molecular Formula | C29H27F3N6O2 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-[5-oxo-11-[3-(trifluoromethyl)phenyl]-1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraen-7-yl]acetamide |
| SMILES | O=C(CN1CCC(Cc2ccccc2)CC1)Nc1nc(=O)c2cnn3c2n1CC=C3c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H27F3N6O2/c30-29(31,32)22-8-4-7-21(16-22)24-11-14-37-27-23(17-33-38(24)27)26(40)35-28(37)34-25(39)18-36-12-9-20(10-13-36)15-19-5-2-1-3-6-19/h1-8,11,16-17,20H,9-10,12-15,18H2,(H,34,35,39,40) |
| InChIKey | FBZFJLDKAAAKBW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |