C9H13N3O2 — CID 157037440
N-[(2R,3R)-2-(1H-pyrazol-5-yl)oxolan-3-yl]acetamide (PubChem CID 157037440) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is N-[(2R,3R)-2-(1H-pyrazol-5-yl)oxolan-3-yl]acetamide.
| Compound Name | N-[(2R,3R)-2-(1H-pyrazol-5-yl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 157037440 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N-[(2R,3R)-2-(1H-pyrazol-5-yl)oxolan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCO[C@H]1c1ccn[nH]1 |
| InChI | InChI=1S/C9H13N3O2/c1-6(13)11-7-3-5-14-9(7)8-2-4-10-12-8/h2,4,7,9H,3,5H2,1H3,(H,10,12)(H,11,13)/t7-,9-/m1/s1 |
| InChIKey | JFVQWUKSSOQOFH-VXNVDRBHSA-N |
| XLogP | 0.38 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |