C47H97NO3 — CID 157043286
N-butyl-N-undecan-5-ylnonanamide;hexane;2-hexyldecyl formate (PubChem CID 157043286) has the molecular formula C47H97NO3 and a molecular weight of 724.30 g/mol. Its IUPAC name is N-butyl-N-undecan-5-ylnonanamide;hexane;2-hexyldecyl formate.
| Compound Name | N-butyl-N-undecan-5-ylnonanamide;hexane;2-hexyldecyl formate |
|---|---|
| PubChem CID | 157043286 |
| Molecular Formula | C47H97NO3 |
| Molecular Weight | 724.30 g/mol |
| Exact Mass | 723.75 |
| IUPAC Name | N-butyl-N-undecan-5-ylnonanamide;hexane;2-hexyldecyl formate |
| SMILES | CCCCCC.CCCCCCCCC(=O)N(CCCC)C(CCCC)CCCCCC.CCCCCCCCC(CCCCCC)COC=O |
| InChI | InChI=1S/C24H49NO.C17H34O2.C6H14/c1-5-9-13-15-16-18-21-24(26)25(22-12-8-4)23(19-11-7-3)20-17-14-10-6-2;1-3-5-7-9-10-12-14-17(15-19-16-18)13-11-8-6-4-2;1-3-5-6-4-2/h23H,5-22H2,1-4H3;16-17H,3-15H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | QMEBXUXCLSIWTF-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.30 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|