C25H25Cl2N3O6 — CID 157058349
N-[3-[[6-[2-(2,6-dichloro-3,5-dimethoxyphenyl)acetyl]furo[3,2-d]pyrimidin-2-yl]methyl]oxan-4-yl]prop-2-enamide (PubChem CID 157058349) has the molecular formula C25H25Cl2N3O6 and a molecular weight of 534.40 g/mol. Its IUPAC name is N-[3-[[6-[2-(2,6-dichloro-3,5-dimethoxyphenyl)acetyl]furo[3,2-d]pyrimidin-2-yl]methyl]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[3-[[6-[2-(2,6-dichloro-3,5-dimethoxyphenyl)acetyl]furo[3,2-d]pyrimidin-2-yl]methyl]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 157058349 |
| Molecular Formula | C25H25Cl2N3O6 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | N-[3-[[6-[2-(2,6-dichloro-3,5-dimethoxyphenyl)acetyl]furo[3,2-d]pyrimidin-2-yl]methyl]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCOCC1Cc1ncc2oc(C(=O)Cc3c(Cl)c(OC)cc(OC)c3Cl)cc2n1 |
| InChI | InChI=1S/C25H25Cl2N3O6/c1-4-23(32)30-15-5-6-35-12-13(15)7-22-28-11-21-16(29-22)9-18(36-21)17(31)8-14-24(26)19(33-2)10-20(34-3)25(14)27/h4,9-11,13,15H,1,5-8,12H2,2-3H3,(H,30,32) |
| InChIKey | VMCIRFGSCVGHPS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|