C38H46F3IrN2O2- — CID 157085145
3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-8-(3,3,3-trifluoro-2,2-dimethylpropyl)-3,7-phenanthroline;iridium (PubChem CID 157085145) has the molecular formula C38H46F3IrN2O2- and a molecular weight of 812.01 g/mol. Its IUPAC name is 3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-8-(3,3,3-trifluoro-2,2-dimethylpropyl)-3,7-phenanthroline;iridium.
| Compound Name | 3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-8-(3,3,3-trifluoro-2,2-dimethylpropyl)-3,7-phenanthroline;iridium |
|---|---|
| PubChem CID | 157085145 |
| Molecular Formula | C38H46F3IrN2O2- |
| Molecular Weight | 812.01 g/mol |
| Exact Mass | 812.31 |
| IUPAC Name | 3,7-diethyl-6-hydroxynon-5-en-4-one;4-(3,5-dimethylbenzene-6-id-1-yl)-8-(3,3,3-trifluoro-2,2-dimethylpropyl)-3,7-phenanthroline;iridium |
| SMILES | CCC(CC)C(=O)C=C(O)C(CC)CC.Cc1[c-]c(-c2nccc3c2ccc2nc(CC(C)(C)C(F)(F)F)ccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C25H22F3N2.C13H24O2.Ir/c1-15-11-16(2)13-17(12-15)23-21-7-8-22-20(19(21)9-10-29-23)6-5-18(30-22)14-24(3,4)25(26,27)28;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-12H,14H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;; |
| InChIKey | OAPBTGDXIRPEHH-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.01 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|