C30H44N6O9S — CID 157089348
tert-butyl 3-[(4-methoxyphenyl)hydrazinylidene]azetidine-1-carboxylate;tert-butyl 3-oxoazetidine-1-carboxylate;4-methoxybenzenesulfonohydrazide (PubChem CID 157089348) has the molecular formula C30H44N6O9S and a molecular weight of 664.78 g/mol. Its IUPAC name is tert-butyl 3-[(4-methoxyphenyl)hydrazinylidene]azetidine-1-carboxylate;tert-butyl 3-oxoazetidine-1-carboxylate;4-methoxybenzenesulfonohydrazide.
| Compound Name | tert-butyl 3-[(4-methoxyphenyl)hydrazinylidene]azetidine-1-carboxylate;tert-butyl 3-oxoazetidine-1-carboxylate;4-methoxybenzenesulfonohydrazide |
|---|---|
| PubChem CID | 157089348 |
| Molecular Formula | C30H44N6O9S |
| Molecular Weight | 664.78 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | tert-butyl 3-[(4-methoxyphenyl)hydrazinylidene]azetidine-1-carboxylate;tert-butyl 3-oxoazetidine-1-carboxylate;4-methoxybenzenesulfonohydrazide |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C1.COc1ccc(NN=C2CN(C(=O)OC(C)(C)C)C2)cc1.COc1ccc(S(=O)(=O)NN)cc1 |
| InChI | InChI=1S/C15H21N3O3.C8H13NO3.C7H10N2O3S/c1-15(2,3)21-14(19)18-9-12(10-18)17-16-11-5-7-13(20-4)8-6-11;1-8(2,3)12-7(11)9-4-6(10)5-9;1-12-6-2-4-7(5-3-6)13(10,11)9-8/h5-8,16H,9-10H2,1-4H3;4-5H2,1-3H3;2-5,9H,8H2,1H3 |
| InChIKey | AEMBVBQWHBDNJQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 191.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|