C8H14N4O8S2 — CID 157092412
6-amino-1,1-dioxothiazinan-3-one;6-nitro-1,1-dioxothiazinan-3-one (PubChem CID 157092412) has the molecular formula C8H14N4O8S2 and a molecular weight of 358.35 g/mol. Its IUPAC name is 6-amino-1,1-dioxothiazinan-3-one;6-nitro-1,1-dioxothiazinan-3-one.
| Compound Name | 6-amino-1,1-dioxothiazinan-3-one;6-nitro-1,1-dioxothiazinan-3-one |
|---|---|
| PubChem CID | 157092412 |
| Molecular Formula | C8H14N4O8S2 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 6-amino-1,1-dioxothiazinan-3-one;6-nitro-1,1-dioxothiazinan-3-one |
| SMILES | NC1CCC(=O)NS1(=O)=O.O=C1CCC([N+](=O)[O-])S(=O)(=O)N1 |
| InChI | InChI=1S/C4H6N2O5S.C4H8N2O3S/c7-3-1-2-4(6(8)9)12(10,11)5-3;5-3-1-2-4(7)6-10(3,8)9/h4H,1-2H2,(H,5,7);3H,1-2,5H2,(H,6,7) |
| InChIKey | AEUUUQOMPBMEQH-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 195.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|