C23H19N2O+ — CID 157100700
9-(1,4-dimethylpyridin-1-ium-2-yl)-10-methyl-[1]benzofuro[3,2-c]isoquinoline (PubChem CID 157100700) has the molecular formula C23H19N2O+ and a molecular weight of 339.42 g/mol. Its IUPAC name is 9-(1,4-dimethylpyridin-1-ium-2-yl)-10-methyl-[1]benzofuro[3,2-c]isoquinoline.
| Compound Name | 9-(1,4-dimethylpyridin-1-ium-2-yl)-10-methyl-[1]benzofuro[3,2-c]isoquinoline |
|---|---|
| PubChem CID | 157100700 |
| Molecular Formula | C23H19N2O+ |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 9-(1,4-dimethylpyridin-1-ium-2-yl)-10-methyl-[1]benzofuro[3,2-c]isoquinoline |
| SMILES | Cc1cc[n+](C)c(-c2ccc3c(oc4c5ccccc5cnc34)c2C)c1 |
| InChI | InChI=1S/C23H19N2O/c1-14-10-11-25(3)20(12-14)17-8-9-19-21-23(26-22(19)15(17)2)18-7-5-4-6-16(18)13-24-21/h4-13H,1-3H3/q+1 |
| InChIKey | QWTLRFAVZQJFSJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|