C37H45N3O6 — CID 157119964
[4-[4-(4-hexoxy-2-hydroxyphenyl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]methyl 2,2-dimethylbutanoate (PubChem CID 157119964) has the molecular formula C37H45N3O6 and a molecular weight of 627.78 g/mol. Its IUPAC name is [4-[4-(4-hexoxy-2-hydroxyphenyl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]methyl 2,2-dimethylbutanoate.
| Compound Name | [4-[4-(4-hexoxy-2-hydroxyphenyl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 157119964 |
| Molecular Formula | C37H45N3O6 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | [4-[4-(4-hexoxy-2-hydroxyphenyl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]methyl 2,2-dimethylbutanoate |
| SMILES | CCCCCCOc1ccc(-c2nc(-c3ccc(OCOC(=O)C(C)(C)CC)cc3O)nc(-c3c(C)cc(C)cc3C)n2)c(O)c1 |
| InChI | InChI=1S/C37H45N3O6/c1-8-10-11-12-17-44-26-13-15-28(30(41)20-26)33-38-34(40-35(39-33)32-24(4)18-23(3)19-25(32)5)29-16-14-27(21-31(29)42)45-22-46-36(43)37(6,7)9-2/h13-16,18-21,41-42H,8-12,17,22H2,1-7H3 |
| InChIKey | GIAKRFKMHJHXSY-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|