About 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide
2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide (PubChem CID 157126818) has the molecular formula C12H9Cl2N3O2
and a molecular weight of 298.13 g/mol. Its IUPAC name is 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide |
| PubChem CID | 157126818 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.O=C(Cl)c1cccnc1Cl |
| InChI | InChI=1S/C6H3Cl2NO.C6H6N2O/c7-5-4(6(8)10)2-1-3-9-5;7-6(9)5-2-1-3-8-4-5/h1-3H;1-4H,(H2,7,9) |
| InChIKey | AIPGUDBNCUTDMG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide?
The IUPAC name of 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide (CID 157126818) is 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide.
What is the SMILES notation for 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide?
The canonical SMILES for 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide is NC(=O)c1cccnc1.O=C(Cl)c1cccnc1Cl.
What is the InChIKey of 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide?
The InChIKey is AIPGUDBNCUTDMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2NO.C6H6N2O/c7-5-4(6(8)10)2-1-3-9-5;7-6(9)5-2-1-3-8-4-5/h1-3H;1-4H,(H2,7,9).
What are the key properties of 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide?
2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide has a molecular weight of 298.13 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyridine-3-carbonyl chloride;pyridine-3-carboxamide is sourced from PubChem (CID 157126818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).