C23H26ClN3O2S — CID 157135869
4-tert-butyl-N-[4-chloro-2-[(E)-2-ethenyl-4-methyliminobut-2-enimidoyl]phenyl]benzenesulfonamide (PubChem CID 157135869) has the molecular formula C23H26ClN3O2S and a molecular weight of 444.00 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-chloro-2-[(E)-2-ethenyl-4-methyliminobut-2-enimidoyl]phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-chloro-2-[(E)-2-ethenyl-4-methyliminobut-2-enimidoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 157135869 |
| Molecular Formula | C23H26ClN3O2S |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 4-tert-butyl-N-[4-chloro-2-[(E)-2-ethenyl-4-methyliminobut-2-enimidoyl]phenyl]benzenesulfonamide |
| SMILES | [H]/N=C(C(\C=C)=C\C=N\C)/c1cc(Cl)ccc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H26ClN3O2S/c1-6-16(13-14-26-5)22(25)20-15-18(24)9-12-21(20)27-30(28,29)19-10-7-17(8-11-19)23(2,3)4/h6-15,25,27H,1H2,2-5H3/b16-13+,25-22+,26-14+ |
| InChIKey | AJPPVKVRGPYWEL-ZBZUUNCJSA-N |
| XLogP | 5.62 |
| TPSA | 82.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|