C23H30ClN3O3S — CID 89298124
N-[1-[2-[(4-tert-butylphenyl)sulfonylamino]-5-chlorophenyl]ethenyl]-N-[(2S)-1-hydroxypropan-2-yl]ethanimidamide (PubChem CID 89298124) has the molecular formula C23H30ClN3O3S and a molecular weight of 464.03 g/mol. Its IUPAC name is N-[1-[2-[(4-tert-butylphenyl)sulfonylamino]-5-chlorophenyl]ethenyl]-N-[(2S)-1-hydroxypropan-2-yl]ethanimidamide.
| Compound Name | N-[1-[2-[(4-tert-butylphenyl)sulfonylamino]-5-chlorophenyl]ethenyl]-N-[(2S)-1-hydroxypropan-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 89298124 |
| Molecular Formula | C23H30ClN3O3S |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[1-[2-[(4-tert-butylphenyl)sulfonylamino]-5-chlorophenyl]ethenyl]-N-[(2S)-1-hydroxypropan-2-yl]ethanimidamide |
| SMILES | [H]/N=C(\C)N(C(=C)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1)[C@@H](C)CO |
| InChI | InChI=1S/C23H30ClN3O3S/c1-15(14-28)27(17(3)25)16(2)21-13-19(24)9-12-22(21)26-31(29,30)20-10-7-18(8-11-20)23(4,5)6/h7-13,15,25-26,28H,2,14H2,1,3-6H3/b25-17+/t15-/m0/s1 |
| InChIKey | HUWMEODEJQIOFT-FTCHKQIRSA-N |
| XLogP | 5.09 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|