C13H26O5 — CID 157144346
(2R,3R,4R,5R,6S)-2-(butoxymethyl)-6-methoxy-2,5-dimethyloxane-3,4-diol (PubChem CID 157144346) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(butoxymethyl)-6-methoxy-2,5-dimethyloxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(butoxymethyl)-6-methoxy-2,5-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 157144346 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(butoxymethyl)-6-methoxy-2,5-dimethyloxane-3,4-diol |
| SMILES | CCCCOC[C@@]1(C)O[C@H](OC)[C@H](C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H26O5/c1-5-6-7-17-8-13(3)11(15)10(14)9(2)12(16-4)18-13/h9-12,14-15H,5-8H2,1-4H3/t9-,10-,11-,12+,13-/m1/s1 |
| InChIKey | TZKVRMKITUFWJG-NJMOYASZSA-N |
| XLogP | 0.92 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|