C21H23BN2O5 — CID 157152860
2-[2-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetyl]-N-(2-aminoethyl)benzamide (PubChem CID 157152860) has the molecular formula C21H23BN2O5 and a molecular weight of 394.24 g/mol. Its IUPAC name is 2-[2-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetyl]-N-(2-aminoethyl)benzamide.
| Compound Name | 2-[2-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetyl]-N-(2-aminoethyl)benzamide |
|---|---|
| PubChem CID | 157152860 |
| Molecular Formula | C21H23BN2O5 |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-[2-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetyl]-N-(2-aminoethyl)benzamide |
| SMILES | CC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)c1ccccc1C(=O)NCCN)C2 |
| InChI | InChI=1S/C21H23BN2O5/c1-13(25)16-8-4-5-14-11-15(22(28)29-20(14)16)12-19(26)17-6-2-3-7-18(17)21(27)24-10-9-23/h2-8,15,28H,9-12,23H2,1H3,(H,24,27)/t15-/m1/s1 |
| InChIKey | UHLUNNJIWFVSLG-OAHLLOKOSA-N |
| XLogP | 1.64 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|