C26H40BNO4 — CID 157107050
1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-[4-(4,4-dimethylpentylamino)cyclohexyl]propan-2-one (PubChem CID 157107050) has the molecular formula C26H40BNO4 and a molecular weight of 441.42 g/mol. Its IUPAC name is 1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-[4-(4,4-dimethylpentylamino)cyclohexyl]propan-2-one.
| Compound Name | 1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-[4-(4,4-dimethylpentylamino)cyclohexyl]propan-2-one |
|---|---|
| PubChem CID | 157107050 |
| Molecular Formula | C26H40BNO4 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-[4-(4,4-dimethylpentylamino)cyclohexyl]propan-2-one |
| SMILES | CC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)CC1CCC(NCCCC(C)(C)C)CC1)C2 |
| InChI | InChI=1S/C26H40BNO4/c1-18(29)24-8-5-7-20-16-21(27(31)32-25(20)24)17-23(30)15-19-9-11-22(12-10-19)28-14-6-13-26(2,3)4/h5,7-8,19,21-22,28,31H,6,9-17H2,1-4H3/t19?,21-,22?/m1/s1 |
| InChIKey | SQMQRPNRPBYWGL-NJEKYYFSSA-N |
| XLogP | 5.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|