C26H40BN3O4 — CID 157441430
4-[[4-[3-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-oxopropyl]cyclohexyl]amino]-N'-propan-2-ylbutanimidamide (PubChem CID 157441430) has the molecular formula C26H40BN3O4 and a molecular weight of 469.44 g/mol. Its IUPAC name is 4-[[4-[3-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-oxopropyl]cyclohexyl]amino]-N'-propan-2-ylbutanimidamide.
| Compound Name | 4-[[4-[3-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-oxopropyl]cyclohexyl]amino]-N'-propan-2-ylbutanimidamide |
|---|---|
| PubChem CID | 157441430 |
| Molecular Formula | C26H40BN3O4 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | 4-[[4-[3-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-oxopropyl]cyclohexyl]amino]-N'-propan-2-ylbutanimidamide |
| SMILES | CC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)CC1CCC(NCCC/C(N)=N/C(C)C)CC1)C2 |
| InChI | InChI=1S/C26H40BN3O4/c1-17(2)30-25(28)8-5-13-29-22-11-9-19(10-12-22)14-23(32)16-21-15-20-6-4-7-24(18(3)31)26(20)34-27(21)33/h4,6-7,17,19,21-22,29,33H,5,8-16H2,1-3H3,(H2,28,30)/t19?,21-,22?/m1/s1 |
| InChIKey | QKKKGYKMETVBEA-NJEKYYFSSA-N |
| XLogP | 3.72 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|