C22H21BO4 — CID 157337317
1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-(3H-inden-5-yl)propan-2-one (PubChem CID 157337317) has the molecular formula C22H21BO4 and a molecular weight of 360.22 g/mol. Its IUPAC name is 1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-(3H-inden-5-yl)propan-2-one.
| Compound Name | 1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-(3H-inden-5-yl)propan-2-one |
|---|---|
| PubChem CID | 157337317 |
| Molecular Formula | C22H21BO4 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-3-(3H-inden-5-yl)propan-2-one |
| SMILES | CC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)Cc1ccc3c(c1)CC=C3)C2 |
| InChI | InChI=1S/C22H21BO4/c1-14(24)21-7-3-6-18-12-19(23(26)27-22(18)21)13-20(25)11-15-8-9-16-4-2-5-17(16)10-15/h2-4,6-10,19,26H,5,11-13H2,1H3/t19-/m1/s1 |
| InChIKey | MQXSFMAJZJOPJZ-LJQANCHMSA-N |
| XLogP | 3.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|