C18H20BN3O5 — CID 90281603
(3R)-3-[2-(2-aminoethylcarbamoyl)anilino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 90281603) has the molecular formula C18H20BN3O5 and a molecular weight of 369.19 g/mol. Its IUPAC name is (3R)-3-[2-(2-aminoethylcarbamoyl)anilino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[2-(2-aminoethylcarbamoyl)anilino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 90281603 |
| Molecular Formula | C18H20BN3O5 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (3R)-3-[2-(2-aminoethylcarbamoyl)anilino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NCCNC(=O)c1ccccc1N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C18H20BN3O5/c20-8-9-21-17(23)12-5-1-2-7-14(12)22-15-10-11-4-3-6-13(18(24)25)16(11)27-19(15)26/h1-7,15,22,26H,8-10,20H2,(H,21,23)(H,24,25)/t15-/m0/s1 |
| InChIKey | YSMJBYHLFVDLAS-HNNXBMFYSA-N |
| XLogP | 0.51 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|