C31H36ClN5O5 — CID 157156398
4-[3-[1-[3-(4-carboxyphenyl)propyl]-3-[2-(3,5-diamino-6-chloropyrazin-2-yl)-2-oxoethyl]piperidin-1-ium-1-yl]propyl]benzoate (PubChem CID 157156398) has the molecular formula C31H36ClN5O5 and a molecular weight of 594.11 g/mol. Its IUPAC name is 4-[3-[1-[3-(4-carboxyphenyl)propyl]-3-[2-(3,5-diamino-6-chloropyrazin-2-yl)-2-oxoethyl]piperidin-1-ium-1-yl]propyl]benzoate.
| Compound Name | 4-[3-[1-[3-(4-carboxyphenyl)propyl]-3-[2-(3,5-diamino-6-chloropyrazin-2-yl)-2-oxoethyl]piperidin-1-ium-1-yl]propyl]benzoate |
|---|---|
| PubChem CID | 157156398 |
| Molecular Formula | C31H36ClN5O5 |
| Molecular Weight | 594.11 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 4-[3-[1-[3-(4-carboxyphenyl)propyl]-3-[2-(3,5-diamino-6-chloropyrazin-2-yl)-2-oxoethyl]piperidin-1-ium-1-yl]propyl]benzoate |
| SMILES | Nc1nc(N)c(C(=O)CC2CCC[N+](CCCc3ccc(C(=O)[O-])cc3)(CCCc3ccc(C(=O)O)cc3)C2)nc1Cl |
| InChI | InChI=1S/C31H36ClN5O5/c32-27-29(34)36-28(33)26(35-27)25(38)18-22-6-3-17-37(19-22,15-1-4-20-7-11-23(12-8-20)30(39)40)16-2-5-21-9-13-24(14-10-21)31(41)42/h7-14,22H,1-6,15-19H2,(H5-,33,34,36,38,39,40,41,42) |
| InChIKey | ALVYRRXVQCFJFY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|