C14H18 — CID 157161227
2,4-dimethyl-1-(2-methylcyclopenten-1-yl)benzene (PubChem CID 157161227) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 2,4-dimethyl-1-(2-methylcyclopenten-1-yl)benzene.
| Compound Name | 2,4-dimethyl-1-(2-methylcyclopenten-1-yl)benzene |
|---|---|
| PubChem CID | 157161227 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2,4-dimethyl-1-(2-methylcyclopenten-1-yl)benzene |
| SMILES | CC1=C(c2ccc(C)cc2C)CCC1 |
| InChI | InChI=1S/C14H18/c1-10-7-8-14(12(3)9-10)13-6-4-5-11(13)2/h7-9H,4-6H2,1-3H3 |
| InChIKey | ZEDXWENCXRTNNJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |