C38H36N7O11P — CID 157191629
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[4-[[ethoxy(ethynoxy)phosphoryl]oxymethyl]phenyl]acetyl]phenoxy]-5-oxopentanoic acid (PubChem CID 157191629) has the molecular formula C38H36N7O11P and a molecular weight of 797.72 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[4-[[ethoxy(ethynoxy)phosphoryl]oxymethyl]phenyl]acetyl]phenoxy]-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[4-[[ethoxy(ethynoxy)phosphoryl]oxymethyl]phenyl]acetyl]phenoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 157191629 |
| Molecular Formula | C38H36N7O11P |
| Molecular Weight | 797.72 g/mol |
| Exact Mass | 797.22 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[2-[4-[[ethoxy(ethynoxy)phosphoryl]oxymethyl]phenyl]acetyl]phenoxy]-5-oxopentanoic acid |
| SMILES | C#COP(=O)(OCC)OCc1ccc(CC(=O)c2ccccc2OC(=O)CC[C@H](NC(=O)c2ccc(NCc3cnc4nc(N)[nH]c(=O)c4n3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C38H36N7O11P/c1-3-53-57(52,54-4-2)55-22-24-11-9-23(10-12-24)19-30(46)28-7-5-6-8-31(28)56-32(47)18-17-29(37(50)51)43-35(48)25-13-15-26(16-14-25)40-20-27-21-41-34-33(42-27)36(49)45-38(39)44-34/h1,5-16,21,29,40H,4,17-20,22H2,2H3,(H,43,48)(H,50,51)(H3,39,41,44,45,49)/t29-,57?/m0/s1 |
| InChIKey | UUHAISQFSUESAA-QCFQSEQASA-N |
| XLogP | 4.17 |
| TPSA | 264.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|