C40H36N7O12P — CID 136506685
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[4-(4-diethynoxyphosphoryloxybutyl)phenoxy]carbonylphenoxy]-5-oxopentanoic acid (PubChem CID 136506685) has the molecular formula C40H36N7O12P and a molecular weight of 837.74 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[4-(4-diethynoxyphosphoryloxybutyl)phenoxy]carbonylphenoxy]-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[4-(4-diethynoxyphosphoryloxybutyl)phenoxy]carbonylphenoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 136506685 |
| Molecular Formula | C40H36N7O12P |
| Molecular Weight | 837.74 g/mol |
| Exact Mass | 837.22 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-[4-(4-diethynoxyphosphoryloxybutyl)phenoxy]carbonylphenoxy]-5-oxopentanoic acid |
| SMILES | C#COP(=O)(OC#C)OCCCCc1ccc(OC(=O)c2ccccc2OC(=O)CC[C@H](NC(=O)c2ccc(NCc3cnc4nc(N)[nH]c(=O)c4n3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C40H36N7O12P/c1-3-55-60(54,56-4-2)57-22-8-7-9-25-12-18-29(19-13-25)58-39(53)30-10-5-6-11-32(30)59-33(48)21-20-31(38(51)52)45-36(49)26-14-16-27(17-15-26)42-23-28-24-43-35-34(44-28)37(50)47-40(41)46-35/h1-2,5-6,10-19,24,31,42H,7-9,20-23H2,(H,45,49)(H,51,52)(H3,41,43,46,47,50)/t31-/m0/s1 |
| InChIKey | LPYHOFUEBSCWHF-HKBQPEDESA-N |
| XLogP | 4.36 |
| TPSA | 273.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.74 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|