C35H34N7O12P — CID 136506692
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(4-diethynoxyphosphoryloxybutoxycarbonyl)-5-methylphenoxy]-5-oxopentanoic acid (PubChem CID 136506692) has the molecular formula C35H34N7O12P and a molecular weight of 775.67 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(4-diethynoxyphosphoryloxybutoxycarbonyl)-5-methylphenoxy]-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(4-diethynoxyphosphoryloxybutoxycarbonyl)-5-methylphenoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 136506692 |
| Molecular Formula | C35H34N7O12P |
| Molecular Weight | 775.67 g/mol |
| Exact Mass | 775.20 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[2-(4-diethynoxyphosphoryloxybutoxycarbonyl)-5-methylphenoxy]-5-oxopentanoic acid |
| SMILES | C#COP(=O)(OC#C)OCCCCOC(=O)c1ccc(C)cc1OC(=O)CC[C@H](NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C35H34N7O12P/c1-4-51-55(49,52-5-2)53-17-7-6-16-50-34(48)25-13-8-21(3)18-27(25)54-28(43)15-14-26(33(46)47)40-31(44)22-9-11-23(12-10-22)37-19-24-20-38-30-29(39-24)32(45)42-35(36)41-30/h1-2,8-13,18,20,26,37H,6-7,14-17,19H2,3H3,(H,40,44)(H,46,47)(H3,36,38,41,42,45)/t26-/m0/s1 |
| InChIKey | PQVRYIWHDHRUAW-SANMLTNESA-N |
| XLogP | 3.06 |
| TPSA | 273.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|