C22H29ClFN3O2 — CID 157197708
3-(4-chloro-3-fluorophenyl)-N-[1-(3-cyanopropyl)-2,2,6,6-tetramethylpiperidin-4-yl]-2-oxopropanamide (PubChem CID 157197708) has the molecular formula C22H29ClFN3O2 and a molecular weight of 421.94 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-N-[1-(3-cyanopropyl)-2,2,6,6-tetramethylpiperidin-4-yl]-2-oxopropanamide.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-N-[1-(3-cyanopropyl)-2,2,6,6-tetramethylpiperidin-4-yl]-2-oxopropanamide |
|---|---|
| PubChem CID | 157197708 |
| Molecular Formula | C22H29ClFN3O2 |
| Molecular Weight | 421.94 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-N-[1-(3-cyanopropyl)-2,2,6,6-tetramethylpiperidin-4-yl]-2-oxopropanamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)Cc2ccc(Cl)c(F)c2)CC(C)(C)N1CCCC#N |
| InChI | InChI=1S/C22H29ClFN3O2/c1-21(2)13-16(14-22(3,4)27(21)10-6-5-9-25)26-20(29)19(28)12-15-7-8-17(23)18(24)11-15/h7-8,11,16H,5-6,10,12-14H2,1-4H3,(H,26,29) |
| InChIKey | HGXIQDOTCZBXSP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.94 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|