C35H34N8O2 — CID 157218647
(Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-benzyl-2-isocyanoprop-2-enamide;benzylcyanamide (PubChem CID 157218647) has the molecular formula C35H34N8O2 and a molecular weight of 598.71 g/mol. Its IUPAC name is (Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-benzyl-2-isocyanoprop-2-enamide;benzylcyanamide.
| Compound Name | (Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-benzyl-2-isocyanoprop-2-enamide;benzylcyanamide |
|---|---|
| PubChem CID | 157218647 |
| Molecular Formula | C35H34N8O2 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | (Z)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-benzyl-2-isocyanoprop-2-enamide;benzylcyanamide |
| SMILES | N#CNCc1ccccc1.[C-]#[N+]/C(=C\c1c(-c2ccc(C)cc2)c2c(N)ncnc2n1CCCO)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H26N6O2.C8H8N2/c1-18-9-11-20(12-10-18)23-22(33(13-6-14-34)26-24(23)25(28)31-17-32-26)15-21(29-2)27(35)30-16-19-7-4-3-5-8-19;9-7-10-6-8-4-2-1-3-5-8/h3-5,7-12,15,17,34H,6,13-14,16H2,1H3,(H,30,35)(H2,28,31,32);1-5,10H,6H2/b21-15-; |
| InChIKey | ASSHWRDRZYFOMW-XGRJIHFXSA-N |
| XLogP | 5.21 |
| TPSA | 146.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|