C19H28O5S — CID 157239157
methyl (2R,4R,5R)-6-[(1R,2R)-1,2-dihydroxybutyl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 157239157) has the molecular formula C19H28O5S and a molecular weight of 368.50 g/mol. Its IUPAC name is methyl (2R,4R,5R)-6-[(1R,2R)-1,2-dihydroxybutyl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5R)-6-[(1R,2R)-1,2-dihydroxybutyl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 157239157 |
| Molecular Formula | C19H28O5S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl (2R,4R,5R)-6-[(1R,2R)-1,2-dihydroxybutyl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | CC[C@@H](O)[C@@H](O)C1O[C@](Sc2ccccc2)(C(=O)OC)C[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C19H28O5S/c1-5-15(20)16(21)17-13(3)12(2)11-19(24-17,18(22)23-4)25-14-9-7-6-8-10-14/h6-10,12-13,15-17,20-21H,5,11H2,1-4H3/t12-,13-,15-,16-,17?,19-/m1/s1 |
| InChIKey | NFBBBBIZIYKYLK-NHTJRQLBSA-N |
| XLogP | 2.84 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |