C7H10N2O — CID 157244353
(1R)-4,5-dimethyl-3,7-diazabicyclo[4.1.0]hept-4-en-2-one (PubChem CID 157244353) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is (1R)-4,5-dimethyl-3,7-diazabicyclo[4.1.0]hept-4-en-2-one.
| Compound Name | (1R)-4,5-dimethyl-3,7-diazabicyclo[4.1.0]hept-4-en-2-one |
|---|---|
| PubChem CID | 157244353 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (1R)-4,5-dimethyl-3,7-diazabicyclo[4.1.0]hept-4-en-2-one |
| SMILES | CC1=C(C)C2N[C@H]2C(=O)N1 |
| InChI | InChI=1S/C7H10N2O/c1-3-4(2)8-7(10)6-5(3)9-6/h5-6,9H,1-2H3,(H,8,10)/t5?,6-/m1/s1 |
| InChIKey | AVORQKKPXPEPED-PRJDIBJQSA-N |
| XLogP | -0.25 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|