C25H24O13 — CID 157246963
[2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]peroxy-5-formyloxy-3,5-dihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 157246963) has the molecular formula C25H24O13 and a molecular weight of 532.45 g/mol. Its IUPAC name is [2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]peroxy-5-formyloxy-3,5-dihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]peroxy-5-formyloxy-3,5-dihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 157246963 |
| Molecular Formula | C25H24O13 |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | [2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]peroxy-5-formyloxy-3,5-dihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=COC1(O)CC(O)C(OOC(=O)/C=C/c2ccc(O)c(O)c2)C(OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C25H24O13/c26-13-35-25(34)11-20(31)24(38-37-23(33)8-4-15-2-6-17(28)19(30)10-15)21(12-25)36-22(32)7-3-14-1-5-16(27)18(29)9-14/h1-10,13,20-21,24,27-31,34H,11-12H2/b7-3+,8-4+ |
| InChIKey | KNGVXKMQVKLRIY-FCXRPNKRSA-N |
| XLogP | 1.01 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|