C23H35N3O2S2 — CID 157247089
N-[1-[(3aR,4S,5R,6S,7aS)-2-(dimethylamino)-5-methyl-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 157247089) has the molecular formula C23H35N3O2S2 and a molecular weight of 449.69 g/mol. Its IUPAC name is N-[1-[(3aR,4S,5R,6S,7aS)-2-(dimethylamino)-5-methyl-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-[(3aR,4S,5R,6S,7aS)-2-(dimethylamino)-5-methyl-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 157247089 |
| Molecular Formula | C23H35N3O2S2 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-[1-[(3aR,4S,5R,6S,7aS)-2-(dimethylamino)-5-methyl-4-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-yl]ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(=NS(=O)C(C)(C)C)[C@H]1C[C@@H]2SC(N(C)C)=N[C@@H]2[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C23H35N3O2S2/c1-15-18(16(2)25-30(27)23(3,4)5)13-19-20(24-22(29-19)26(6)7)21(15)28-14-17-11-9-8-10-12-17/h8-12,15,18-21H,13-14H2,1-7H3/t15-,18+,19+,20+,21+,30?/m1/s1 |
| InChIKey | GKQDYJWPMXNJMR-LTPJIUOTSA-N |
| XLogP | 4.55 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|