About 2-methylpropylgermane;triethylborane
2-methylpropylgermane;triethylborane (PubChem CID 157255383) has the molecular formula C10H27BGe
and a molecular weight of 230.75 g/mol. Its IUPAC name is 2-methylpropylgermane;triethylborane.
Molecular Properties
| Compound Name | 2-methylpropylgermane;triethylborane |
| PubChem CID | 157255383 |
| Molecular Formula | C10H27BGe |
| Molecular Weight | 230.75 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-methylpropylgermane;triethylborane |
| SMILES | CC(C)C[GeH3].CCB(CC)CC |
| InChI | InChI=1S/C6H15B.C4H12Ge/c1-4-7(5-2)6-3;1-4(2)3-5/h4-6H2,1-3H3;4H,3H2,1-2,5H3 |
| InChIKey | AWVHOUXGORHYCY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropylgermane;triethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylgermane;triethylborane?
The IUPAC name of 2-methylpropylgermane;triethylborane (CID 157255383) is 2-methylpropylgermane;triethylborane.
What is the SMILES notation for 2-methylpropylgermane;triethylborane?
The canonical SMILES for 2-methylpropylgermane;triethylborane is CC(C)C[GeH3].CCB(CC)CC.
What is the InChIKey of 2-methylpropylgermane;triethylborane?
The InChIKey is AWVHOUXGORHYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15B.C4H12Ge/c1-4-7(5-2)6-3;1-4(2)3-5/h4-6H2,1-3H3;4H,3H2,1-2,5H3.
What are the key properties of 2-methylpropylgermane;triethylborane?
2-methylpropylgermane;triethylborane has a molecular weight of 230.75 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylgermane;triethylborane is sourced from PubChem (CID 157255383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).