C9H15N5 — CID 157260453
1-carbamimidoyl-3-cyclopenta-1,4-dien-1-yl-1,3-dimethylguanidine (PubChem CID 157260453) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-carbamimidoyl-3-cyclopenta-1,4-dien-1-yl-1,3-dimethylguanidine.
| Compound Name | 1-carbamimidoyl-3-cyclopenta-1,4-dien-1-yl-1,3-dimethylguanidine |
|---|---|
| PubChem CID | 157260453 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1-carbamimidoyl-3-cyclopenta-1,4-dien-1-yl-1,3-dimethylguanidine |
| SMILES | [H]/N=C(/N(C)C1=CCC=C1)N(C)/C(N)=N/[H] |
| InChI | InChI=1S/C9H15N5/c1-13(7-5-3-4-6-7)9(12)14(2)8(10)11/h3,5-6,12H,4H2,1-2H3,(H3,10,11)/b12-9- |
| InChIKey | CXJYOIITWDTNAY-XFXZXTDPSA-N |
| XLogP | 0.52 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|