C22H38O12P2 — CID 157266665
(5S,6aR)-5-[(E)-2-dimethoxyphosphorylethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 157266665) has the molecular formula C22H38O12P2 and a molecular weight of 556.48 g/mol. Its IUPAC name is (5S,6aR)-5-[(E)-2-dimethoxyphosphorylethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (5S,6aR)-5-[(E)-2-dimethoxyphosphorylethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 157266665 |
| Molecular Formula | C22H38O12P2 |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (5S,6aR)-5-[(E)-2-dimethoxyphosphorylethenyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | COP(=O)(/C=C/[C@@H]1C[C@H]2OC(C)(C)OC2O1)OC.COP(=O)(/C=C/[C@@H]1C[C@H]2OC(C)(C)OC2O1)OC |
| InChI | InChI=1S/2C11H19O6P/c2*1-11(2)16-9-7-8(15-10(9)17-11)5-6-18(12,13-3)14-4/h2*5-6,8-10H,7H2,1-4H3/b2*6-5+/t2*8-,9-,10?/m11/s1 |
| InChIKey | AYBOPXMOYLMHSP-ZRRGPVCBSA-N |
| XLogP | 4.51 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|