C42H24Br2N4O6 — CID 157268687
6-(2-aminophenyl)-8-bromo-[1]benzofuro[3,2-c]isoquinolin-5-one;8-bromo-6-(2-nitrophenyl)-[1]benzofuro[3,2-c]isoquinolin-5-one (PubChem CID 157268687) has the molecular formula C42H24Br2N4O6 and a molecular weight of 840.48 g/mol. Its IUPAC name is 6-(2-aminophenyl)-8-bromo-[1]benzofuro[3,2-c]isoquinolin-5-one;8-bromo-6-(2-nitrophenyl)-[1]benzofuro[3,2-c]isoquinolin-5-one.
| Compound Name | 6-(2-aminophenyl)-8-bromo-[1]benzofuro[3,2-c]isoquinolin-5-one;8-bromo-6-(2-nitrophenyl)-[1]benzofuro[3,2-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 157268687 |
| Molecular Formula | C42H24Br2N4O6 |
| Molecular Weight | 840.48 g/mol |
| Exact Mass | 838.01 |
| IUPAC Name | 6-(2-aminophenyl)-8-bromo-[1]benzofuro[3,2-c]isoquinolin-5-one;8-bromo-6-(2-nitrophenyl)-[1]benzofuro[3,2-c]isoquinolin-5-one |
| SMILES | Nc1ccccc1-n1c(=O)c2ccccc2c2oc3ccc(Br)cc3c21.O=c1c2ccccc2c2oc3ccc(Br)cc3c2n1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H11BrN2O4.C21H13BrN2O2/c22-12-9-10-18-15(11-12)19-20(28-18)13-5-1-2-6-14(13)21(25)23(19)16-7-3-4-8-17(16)24(26)27;22-12-9-10-18-15(11-12)19-20(26-18)13-5-1-2-6-14(13)21(25)24(19)17-8-4-3-7-16(17)23/h1-11H;1-11H,23H2 |
| InChIKey | AYHBKUIWZRWNMW-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.48 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|