C38H42BrFO8S2 — CID 157309259
5-[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylpentyl acetate;5-(4-phenylphenyl)sulfonylpentyl acetate (PubChem CID 157309259) has the molecular formula C38H42BrFO8S2 and a molecular weight of 789.78 g/mol. Its IUPAC name is 5-[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylpentyl acetate;5-(4-phenylphenyl)sulfonylpentyl acetate.
| Compound Name | 5-[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylpentyl acetate;5-(4-phenylphenyl)sulfonylpentyl acetate |
|---|---|
| PubChem CID | 157309259 |
| Molecular Formula | C38H42BrFO8S2 |
| Molecular Weight | 789.78 g/mol |
| Exact Mass | 788.15 |
| IUPAC Name | 5-[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylpentyl acetate;5-(4-phenylphenyl)sulfonylpentyl acetate |
| SMILES | CC(=O)OCCCCCS(=O)(=O)c1ccc(-c2ccc(Br)cc2F)cc1.CC(=O)OCCCCCS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20BrFO4S.C19H22O4S/c1-14(22)25-11-3-2-4-12-26(23,24)17-8-5-15(6-9-17)18-10-7-16(20)13-19(18)21;1-16(20)23-14-6-3-7-15-24(21,22)19-12-10-18(11-13-19)17-8-4-2-5-9-17/h5-10,13H,2-4,11-12H2,1H3;2,4-5,8-13H,3,6-7,14-15H2,1H3 |
| InChIKey | BCVPLIWVFXTVNR-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.78 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|