C23H27F3O3 — CID 157314040
5-[6-(4-methylcyclohexyl)oxy-5-(trifluoromethyl)naphthalen-1-yl]pentanoic acid (PubChem CID 157314040) has the molecular formula C23H27F3O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 5-[6-(4-methylcyclohexyl)oxy-5-(trifluoromethyl)naphthalen-1-yl]pentanoic acid.
| Compound Name | 5-[6-(4-methylcyclohexyl)oxy-5-(trifluoromethyl)naphthalen-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 157314040 |
| Molecular Formula | C23H27F3O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 5-[6-(4-methylcyclohexyl)oxy-5-(trifluoromethyl)naphthalen-1-yl]pentanoic acid |
| SMILES | CC1CCC(Oc2ccc3c(CCCCC(=O)O)cccc3c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H27F3O3/c1-15-9-11-17(12-10-15)29-20-14-13-18-16(5-2-3-8-21(27)28)6-4-7-19(18)22(20)23(24,25)26/h4,6-7,13-15,17H,2-3,5,8-12H2,1H3,(H,27,28) |
| InChIKey | SEJNPMSAPSYQCM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|