C22H23F6NO3 — CID 73294374
3-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]propanoic acid (PubChem CID 73294374) has the molecular formula C22H23F6NO3 and a molecular weight of 463.42 g/mol. Its IUPAC name is 3-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]propanoic acid.
| Compound Name | 3-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 73294374 |
| Molecular Formula | C22H23F6NO3 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 3-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1cccc2c(C(F)(F)F)c(OC3CCC(C(F)(F)F)CC3)ccc12 |
| InChI | InChI=1S/C22H23F6NO3/c23-21(24,25)14-4-6-15(7-5-14)32-18-9-8-16-13(12-29-11-10-19(30)31)2-1-3-17(16)20(18)22(26,27)28/h1-3,8-9,14-15,29H,4-7,10-12H2,(H,30,31) |
| InChIKey | RCGNLXWLRJDYOJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|