C24H26F6O3 — CID 161019767
6-[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]hexanoic acid (PubChem CID 161019767) has the molecular formula C24H26F6O3 and a molecular weight of 476.46 g/mol. Its IUPAC name is 6-[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]hexanoic acid.
| Compound Name | 6-[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 161019767 |
| Molecular Formula | C24H26F6O3 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 6-[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCc1cccc2c(C(F)(F)F)c(OC3CCC(C(F)(F)F)CC3)ccc12 |
| InChI | InChI=1S/C24H26F6O3/c25-23(26,27)16-9-11-17(12-10-16)33-20-14-13-18-15(5-2-1-3-8-21(31)32)6-4-7-19(18)22(20)24(28,29)30/h4,6-7,13-14,16-17H,1-3,5,8-12H2,(H,31,32) |
| InChIKey | ZKGJUSYDKHRGKY-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|