C26H30F6O3 — CID 160739876
8-[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]octanoic acid (PubChem CID 160739876) has the molecular formula C26H30F6O3 and a molecular weight of 504.51 g/mol. Its IUPAC name is 8-[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]octanoic acid.
| Compound Name | 8-[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]octanoic acid |
|---|---|
| PubChem CID | 160739876 |
| Molecular Formula | C26H30F6O3 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 8-[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]octanoic acid |
| SMILES | O=C(O)CCCCCCCc1cccc2c(C(F)(F)F)c(OC3CCC(C(F)(F)F)CC3)ccc12 |
| InChI | InChI=1S/C26H30F6O3/c27-25(28,29)18-11-13-19(14-12-18)35-22-16-15-20-17(7-4-2-1-3-5-10-23(33)34)8-6-9-21(20)24(22)26(30,31)32/h6,8-9,15-16,18-19H,1-5,7,10-14H2,(H,33,34) |
| InChIKey | NQDPLDDDAVVYIP-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|