C25H29F6NO3 — CID 73294377
6-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]hexanoic acid (PubChem CID 73294377) has the molecular formula C25H29F6NO3 and a molecular weight of 505.50 g/mol. Its IUPAC name is 6-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]hexanoic acid.
| Compound Name | 6-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 73294377 |
| Molecular Formula | C25H29F6NO3 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 6-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNCc1cccc2c(C(F)(F)F)c(OC3CCC(C(F)(F)F)CC3)ccc12 |
| InChI | InChI=1S/C25H29F6NO3/c26-24(27,28)17-8-10-18(11-9-17)35-21-13-12-19-16(15-32-14-3-1-2-7-22(33)34)5-4-6-20(19)23(21)25(29,30)31/h4-6,12-13,17-18,32H,1-3,7-11,14-15H2,(H,33,34) |
| InChIKey | YYKPFADAYWWZKB-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|