C26H38F3NO3 — CID 144570538
ethane;methoxymethane;3-[[6-(4-methylcyclohexyl)oxy-5-(trifluoromethyl)naphthalen-1-yl]methylamino]propanal (PubChem CID 144570538) has the molecular formula C26H38F3NO3 and a molecular weight of 469.59 g/mol. Its IUPAC name is ethane;methoxymethane;3-[[6-(4-methylcyclohexyl)oxy-5-(trifluoromethyl)naphthalen-1-yl]methylamino]propanal.
| Compound Name | ethane;methoxymethane;3-[[6-(4-methylcyclohexyl)oxy-5-(trifluoromethyl)naphthalen-1-yl]methylamino]propanal |
|---|---|
| PubChem CID | 144570538 |
| Molecular Formula | C26H38F3NO3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | ethane;methoxymethane;3-[[6-(4-methylcyclohexyl)oxy-5-(trifluoromethyl)naphthalen-1-yl]methylamino]propanal |
| SMILES | CC.CC1CCC(Oc2ccc3c(CNCCC=O)cccc3c2C(F)(F)F)CC1.COC |
| InChI | InChI=1S/C22H26F3NO2.C2H6O.C2H6/c1-15-6-8-17(9-7-15)28-20-11-10-18-16(14-26-12-3-13-27)4-2-5-19(18)21(20)22(23,24)25;1-3-2;1-2/h2,4-5,10-11,13,15,17,26H,3,6-9,12,14H2,1H3;1-2H3;1-2H3 |
| InChIKey | YJUOSEARPJJABU-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|