C22H23F6NO2 — CID 144570535
3-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]propanal (PubChem CID 144570535) has the molecular formula C22H23F6NO2 and a molecular weight of 447.42 g/mol. Its IUPAC name is 3-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]propanal.
| Compound Name | 3-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]propanal |
|---|---|
| PubChem CID | 144570535 |
| Molecular Formula | C22H23F6NO2 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-[[5-(trifluoromethyl)-6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methylamino]propanal |
| SMILES | O=CCCNCc1cccc2c(C(F)(F)F)c(OC3CCC(C(F)(F)F)CC3)ccc12 |
| InChI | InChI=1S/C22H23F6NO2/c23-21(24,25)15-5-7-16(8-6-15)31-19-10-9-17-14(13-29-11-2-12-30)3-1-4-18(17)20(19)22(26,27)28/h1,3-4,9-10,12,15-16,29H,2,5-8,11,13H2 |
| InChIKey | UUSSEBDCRQNZIC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|