C11H25ClN4O5S2 — CID 157319157
azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride (PubChem CID 157319157) has the molecular formula C11H25ClN4O5S2 and a molecular weight of 392.93 g/mol. Its IUPAC name is azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride.
| Compound Name | azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 157319157 |
| Molecular Formula | C11H25ClN4O5S2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)C1CN(CC2CCOC2)C1.NS(=O)(=O)C1CNC1 |
| InChI | InChI=1S/C8H16N2O3S.C3H8N2O2S.ClH/c9-14(11,12)8-4-10(5-8)3-7-1-2-13-6-7;4-8(6,7)3-1-5-2-3;/h7-8H,1-6H2,(H2,9,11,12);3,5H,1-2H2,(H2,4,6,7);1H |
| InChIKey | PTSXRUCBOOXTSJ-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 144.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |