About azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride
azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride (PubChem CID 157319157) has the molecular formula C11H25ClN4O5S2
and a molecular weight of 392.93 g/mol. Its IUPAC name is azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride |
| PubChem CID | 157319157 |
| Molecular Formula | C11H25ClN4O5S2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)C1CN(CC2CCOC2)C1.NS(=O)(=O)C1CNC1 |
| InChI | InChI=1S/C8H16N2O3S.C3H8N2O2S.ClH/c9-14(11,12)8-4-10(5-8)3-7-1-2-13-6-7;4-8(6,7)3-1-5-2-3;/h7-8H,1-6H2,(H2,9,11,12);3,5H,1-2H2,(H2,4,6,7);1H |
| InChIKey | PTSXRUCBOOXTSJ-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 144.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride?
The IUPAC name of azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride (CID 157319157) is azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride.
What is the SMILES notation for azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride?
The canonical SMILES for azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride is Cl.NS(=O)(=O)C1CN(CC2CCOC2)C1.NS(=O)(=O)C1CNC1.
What is the InChIKey of azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride?
The InChIKey is PTSXRUCBOOXTSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3S.C3H8N2O2S.ClH/c9-14(11,12)8-4-10(5-8)3-7-1-2-13-6-7;4-8(6,7)3-1-5-2-3;/h7-8H,1-6H2,(H2,9,11,12);3,5H,1-2H2,(H2,4,6,7);1H.
What are the key properties of azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride?
azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride has a molecular weight of 392.93 g/mol, XLogP of -2.34, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-3-sulfonamide;1-(oxolan-3-ylmethyl)azetidine-3-sulfonamide;hydrochloride is sourced from PubChem (CID 157319157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).