C26H30F2O5S2 — CID 157358369
1-adamantylmethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate;methyl(diphenyl)sulfanium (PubChem CID 157358369) has the molecular formula C26H30F2O5S2 and a molecular weight of 524.65 g/mol. Its IUPAC name is 1-adamantylmethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate;methyl(diphenyl)sulfanium.
| Compound Name | 1-adamantylmethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate;methyl(diphenyl)sulfanium |
|---|---|
| PubChem CID | 157358369 |
| Molecular Formula | C26H30F2O5S2 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 1-adamantylmethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate;methyl(diphenyl)sulfanium |
| SMILES | C[S+](c1ccccc1)c1ccccc1.O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C13H18F2O5S.C13H13S/c14-13(15,21-20-19-17)11(16)18-7-12-4-8-1-9(5-12)3-10(2-8)6-12;1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h8-10,17H,1-7H2;2-11H,1H3/q;+1/p-1 |
| InChIKey | BIIUXLUSTKFBJW-UHFFFAOYSA-M |
| XLogP | 5.56 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|