C16H26O4 — CID 157380093
3,3-bis(hydroxymethyl)-5,5-dimethyl-2-phenylhexane-2,4-diol (PubChem CID 157380093) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 3,3-bis(hydroxymethyl)-5,5-dimethyl-2-phenylhexane-2,4-diol.
| Compound Name | 3,3-bis(hydroxymethyl)-5,5-dimethyl-2-phenylhexane-2,4-diol |
|---|---|
| PubChem CID | 157380093 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3,3-bis(hydroxymethyl)-5,5-dimethyl-2-phenylhexane-2,4-diol |
| SMILES | CC(C)(C)C(O)C(CO)(CO)C(C)(O)c1ccccc1 |
| InChI | InChI=1S/C16H26O4/c1-14(2,3)13(19)16(10-17,11-18)15(4,20)12-8-6-5-7-9-12/h5-9,13,17-20H,10-11H2,1-4H3 |
| InChIKey | QXACVTGHJZLRPL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |