C29H39BN2O5 — CID 157380270
tert-butyl (2S,4S)-4-(methoxymethyl)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 157380270) has the molecular formula C29H39BN2O5 and a molecular weight of 506.45 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-(methoxymethyl)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-(methoxymethyl)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157380270 |
| Molecular Formula | C29H39BN2O5 |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | tert-butyl (2S,4S)-4-(methoxymethyl)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | COC[C@H]1C[C@@H](C2=Nc3ccc4cc(B5OC(C)(C)C(C)(C)O5)ccc4c3C2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C29H39BN2O5/c1-27(2,3)35-26(33)32-16-18(17-34-8)13-25(32)24-15-22-21-11-10-20(14-19(21)9-12-23(22)31-24)30-36-28(4,5)29(6,7)37-30/h9-12,14,18,25H,13,15-17H2,1-8H3/t18-,25-/m0/s1 |
| InChIKey | MBSRDROVZVARMF-BVZFJXPGSA-N |
| XLogP | 5.04 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|